ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-Kloroetil fenil sülfoksit |
|
Ürün Adı | 2-Kloroetil fenil sülfoksit |
Eş anlamlı | ; 2-Kloroetil fenil sülfoksit; [(2-kloroetil)sülfinil]benzen; |
ingilizce adı | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
Moleküler Formülü | C8H9ClOS |
Molekül Ağırlığı | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
CAS kayıt numarası | 27998-60-3 |
EINECS | 248-768-8 |
Moleküler Yapısı | |
Yoğunluk | 1.3g/cm3 |
Kaynama noktası | 330.6°C at 760 mmHg |
Kırılma indisi | 1.601 |
Alevlenme noktası | 153.7°C |
Buhar basıncı | 0.000316mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |