ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-klóretil-fenil-szulfoxid |
|
termék neve | 2-klóretil-fenil-szulfoxid |
Szinonimák | ; 2-klóretil-fenil-szulfoxid; [(2-klóretil)szulfinil]benzol; |
Angol név | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
MF | C8H9ClOS |
Molekulatömeg | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
CAS-szám | 27998-60-3 |
EINECS | 248-768-8 |
Molekuláris szerkezete | |
Sűrűség | 1.3g/cm3 |
Forráspont | 330.6°C at 760 mmHg |
Törésmutató | 1.601 |
Gyulladáspont | 153.7°C |
Gőznyomás | 0.000316mmHg at 25°C |
Kockázatot kódok | R36/38##Irritating to eyes and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |