ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-kloretylfenylsulfoksid |
|
produktnavn | 2-kloretylfenylsulfoksid |
Synonymer | ; 2-kloretylfenylsulfoksid; [(2-kloretyl)sulfinyl]benzen; |
Engelsk navn | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
Molekylær Formel | C8H9ClOS |
Molekylvekt | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
CAS-nummer | 27998-60-3 |
EINECS | 248-768-8 |
Molecular Structure | |
Tetthet | 1.3g/cm3 |
Kokepunkt | 330.6°C at 760 mmHg |
Brytningsindeks | 1.601 |
Flammepunktet | 153.7°C |
Damptrykk | 0.000316mmHg at 25°C |
Risiko Koder | R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |