ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-क्लोरोइथाइल फिनाइल सल्फोक्साइड |
|
उत्पाद का नाम | 2-क्लोरोइथाइल फिनाइल सल्फोक्साइड |
समानार्थी | ; 2-क्लोरोइथाइल फिनाइल सल्फोक्साइड; [(2-क्लोरोइथाइल) सल्फिनिल] बेंजीन; |
अंग्रेज | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
आणविक फार्मूला | C8H9ClOS |
आण्विक वजन | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
कैस रजिस्टी संख्या | 27998-60-3 |
EINECS | 248-768-8 |
आणविक संरचना | |
घनत्व | 1.3g/cm3 |
उबलने का समय | 330.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.601 |
फ्लैश प्वाइंट | 153.7°C |
वाष्प का दबाव | 0.000316mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |