ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-chloroetylosulfotlenek fenylu |
|
Nazwa produktu: | 2-chloroetylosulfotlenek fenylu |
Synonimy | 2-chloroetylosulfotlenek fenylu; [(2-chloroetylo)sulfinylo]benzen; |
Angielska nazwa | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
MF | C8H9ClOS |
Masie cząsteczkowej | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
Nr CAS | 27998-60-3 |
EINECS | 248-768-8 |
Struktury molekularnej | |
Gęstość | 1.3g/cm3 |
Temperatura wrzenia | 330.6°C at 760 mmHg |
Współczynnik załamania | 1.601 |
Temperatura zapłonu | 153.7°C |
Ciśnienie pary | 0.000316mmHg at 25°C |
Kody ryzyka | R36/38##Irritating to eyes and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |