ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27998-60-3 2-کلروتیل فنیل سولفوکسید؛ 2-کلروتیل فنیل سولفوکسید؛ [(2-chloroethyl) sulfinyl]بنزن؛ |
|
نام محصول | 2-کلروتیل فنیل سولفوکسید؛ 2-کلروتیل فنیل سولفوکسید؛ [(2-chloroethyl) sulfinyl]بنزن؛ |
نام انگلیسی | 2-Chloroethyl phenyl sulphoxide;2-Chloroethyl phenyl sulfoxide;[(2-chloroethyl)sulfinyl]benzene |
میدان مغناطیسی | C8H9ClOS |
وزن مولکولی | 188.6745 |
InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
شماره سیایاس | 27998-60-3 |
تعداد کمیسیون اروپایی | 248-768-8 |
ساختار مولکولی | |
تراکم | 1.3g/cm3 |
نقطه غلیان | 330.6°C at 760 mmHg |
ضریب شکست | 1.601 |
نقطه اشتعال | 153.7°C |
فشار بخار | 0.000316mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |