Chemindex > 4693-91-8 4-methoxyphenylacetyl chloride
TR ▼
4693-91-8 4-methoxyphenylacetyl chloride |
|
| Ürün Adı | 4-methoxyphenylacetyl chloride |
| ingilizce adı | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
| Moleküler Formülü | C9H9ClO2 |
| Molekül Ağırlığı | 184.6196 |
| InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| CAS kayıt numarası | 4693-91-8 |
| Moleküler Yapısı |  |
| Yoğunluk | 1.192g/cm3 |
| Kaynama noktası | 280.1°C at 760 mmHg |
| Kırılma indisi | 1.524 |
| Alevlenme noktası | 100°C |
| Buhar basıncı | 0.00387mmHg at 25°C |
| Tehlike Sembolleri |  C##Corrosive:; |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
4693-91-8(0) için tedarikçiler:
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 