Chemindex > 4693-91-8 4-methoxyphenylacetyl chloride
MY ▼
4693-91-8 4-methoxyphenylacetyl chloride |
|
| Nama produk | 4-methoxyphenylacetyl chloride |
| Nama Inggeris | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
| MF | C9H9ClO2 |
| Berat Molekul | 184.6196 |
| InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| CAS NO | 4693-91-8 |
| Struktur Molekul |  |
| Kepadatan | 1.192g/cm3 |
| Titik didih | 280.1°C at 760 mmHg |
| Indeks bias | 1.524 |
| Titik nyala | 100°C |
| Tekanan wap | 0.00387mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 4693-91-8(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 