Chemindex > 4693-91-8 4-methoxyphenylacetyl chloride
SA ▼
4693-91-8 4-methoxyphenylacetyl chloride |
|
| اسم المنتج | 4-methoxyphenylacetyl chloride |
| الاسم بالانجليزية | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
| الصيغة الجزيئية | C9H9ClO2 |
| الوزن الجزيئي الغرامي | 184.6196 |
| InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| إستراتيجية المساعدة القطرية | 4693-91-8 |
| بنية جزيئية |  |
| كثافة | 1.192g/cm3 |
| نقطة الغليان | 280.1°C at 760 mmHg |
| معامل الإنكسار | 1.524 |
| نقطة الوميض | 100°C |
| ضغط البخار | 0.00387mmHg at 25°C |
| علامات على البضائع الخطرة |  C##Corrosive:; |
| خطر المصطلحات | R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 4693-91-8(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 