ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4693-91-8 4-methoxyphenylacetyl chloride |
|
Nazwa produktu: | 4-methoxyphenylacetyl chloride |
Angielska nazwa | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
MF | C9H9ClO2 |
Masie cząsteczkowej | 184.6196 |
InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
Nr CAS | 4693-91-8 |
Struktury molekularnej | |
Gęstość | 1.192g/cm3 |
Temperatura wrzenia | 280.1°C at 760 mmHg |
Współczynnik załamania | 1.524 |
Temperatura zapłonu | 100°C |
Ciśnienie pary | 0.00387mmHg at 25°C |
Symbole zagrożenia | C##Corrosive:; |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |