Chemindex > 4693-91-8 4-methoxyphenylacetyl chloride
NO ▼
4693-91-8 4-methoxyphenylacetyl chloride |
|
| produktnavn | 4-methoxyphenylacetyl chloride |
| Engelsk navn | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
| Molekylær Formel | C9H9ClO2 |
| Molekylvekt | 184.6196 |
| InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| CAS-nummer | 4693-91-8 |
| Molecular Structure |  |
| Tetthet | 1.192g/cm3 |
| Kokepunkt | 280.1°C at 760 mmHg |
| Brytningsindeks | 1.524 |
| Flammepunktet | 100°C |
| Damptrykk | 0.00387mmHg at 25°C |
| Hazard symboler |  C##Corrosive:; |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 4693-91-8(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 