ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33898-90-7 2-Thenoylacetonitrile |
|
Ürün Adı | 2-Thenoylacetonitrile |
ingilizce adı | 2-Thenoylacetonitrile;3-Oxo-3-(2-thienyl)propionitrile;3-Oxo-3-(2-thienyl)propanenitrile;3-oxo-3-(thiophen-2-yl)propanenitrile |
Moleküler Formülü | C7H5NOS |
Molekül Ağırlığı | 151.1857 |
InChI | InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS kayıt numarası | 33898-90-7 |
Moleküler Yapısı | |
Yoğunluk | 1.256g/cm3 |
Ergime noktası | 128-134℃ |
Kaynama noktası | 338.3°C at 760 mmHg |
Kırılma indisi | 1.565 |
Alevlenme noktası | 158.4°C |
Buhar basıncı | 9.88E-05mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |