ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33898-90-7 2-Thenoylacetonitrile |
|
نام محصول | 2-Thenoylacetonitrile |
نام انگلیسی | 2-Thenoylacetonitrile;3-Oxo-3-(2-thienyl)propionitrile;3-Oxo-3-(2-thienyl)propanenitrile;3-oxo-3-(thiophen-2-yl)propanenitrile |
میدان مغناطیسی | C7H5NOS |
وزن مولکولی | 151.1857 |
InChI | InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
شماره سیایاس | 33898-90-7 |
ساختار مولکولی | |
تراکم | 1.256g/cm3 |
نقطه ذوب | 128-134℃ |
نقطه غلیان | 338.3°C at 760 mmHg |
ضریب شکست | 1.565 |
نقطه اشتعال | 158.4°C |
فشار بخار | 9.88E-05mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |