ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33898-90-7 2-Thenoylacetonitrile |
|
produktnavn | 2-Thenoylacetonitrile |
Engelsk navn | 2-Thenoylacetonitrile;3-Oxo-3-(2-thienyl)propionitrile;3-Oxo-3-(2-thienyl)propanenitrile;3-oxo-3-(thiophen-2-yl)propanenitrile |
Molekylær Formel | C7H5NOS |
Molekylvekt | 151.1857 |
InChI | InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS-nummer | 33898-90-7 |
Molecular Structure | |
Tetthet | 1.256g/cm3 |
Smeltepunkt | 128-134℃ |
Kokepunkt | 338.3°C at 760 mmHg |
Brytningsindeks | 1.565 |
Flammepunktet | 158.4°C |
Damptrykk | 9.88E-05mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |