ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33898-90-7 2-Thenoylacetonitrile |
|
उत्पाद का नाम | 2-Thenoylacetonitrile |
अंग्रेज | 2-Thenoylacetonitrile;3-Oxo-3-(2-thienyl)propionitrile;3-Oxo-3-(2-thienyl)propanenitrile;3-oxo-3-(thiophen-2-yl)propanenitrile |
आणविक फार्मूला | C7H5NOS |
आण्विक वजन | 151.1857 |
InChI | InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
कैस रजिस्टी संख्या | 33898-90-7 |
आणविक संरचना | |
घनत्व | 1.256g/cm3 |
गलनांक | 128-134℃ |
उबलने का समय | 338.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.565 |
फ्लैश प्वाइंट | 158.4°C |
वाष्प का दबाव | 9.88E-05mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |