ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33898-90-7 2-Thenoylacetonitrile |
|
اسم المنتج | 2-Thenoylacetonitrile |
الاسم بالانجليزية | 2-Thenoylacetonitrile;3-Oxo-3-(2-thienyl)propionitrile;3-Oxo-3-(2-thienyl)propanenitrile;3-oxo-3-(thiophen-2-yl)propanenitrile |
الصيغة الجزيئية | C7H5NOS |
الوزن الجزيئي الغرامي | 151.1857 |
InChI | InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
إستراتيجية المساعدة القطرية | 33898-90-7 |
بنية جزيئية | |
كثافة | 1.256g/cm3 |
درجة الإنصهار | 128-134℃ |
نقطة الغليان | 338.3°C at 760 mmHg |
معامل الإنكسار | 1.565 |
نقطة الوميض | 158.4°C |
ضغط البخار | 9.88E-05mmHg at 25°C |
علامات على البضائع الخطرة | Xn##Harmful:; |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |