Chemindex > 23163-84-0
SA ▼
23163-84-0 2-ethoxyphenyl isothiocyanate |
|
| اسم المنتج | 2-ethoxyphenyl isothiocyanate |
| الاسم بالانجليزية | 2-ethoxyphenyl isothiocyanate;o-Ethoxyphenyl isothiocyanate;1-ethoxy-2-isothiocyanatobenzene |
| الصيغة الجزيئية | C9H9NOS |
| الوزن الجزيئي الغرامي | 179.2389 |
| InChI | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| إستراتيجية المساعدة القطرية | 23163-84-0 |
| المفوضية الأوروبية رقم | 245-468-9 |
| بنية جزيئية |  |
| كثافة | 1.06g/cm3 |
| نقطة الغليان | 293.2°C at 760 mmHg |
| معامل الإنكسار | 1.544 |
| نقطة الوميض | 131.1°C |
| ضغط البخار | 0.00306mmHg at 25°C |
| علامات على البضائع الخطرة |  Xn##Harmful:; |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 