Chemindex >23163-84-0
MY ▼
23163-84-0 2-ethoxyphenyl isothiocyanate |
|
| Nama produk | 2-ethoxyphenyl isothiocyanate |
| Nama Inggeris | 2-ethoxyphenyl isothiocyanate;o-Ethoxyphenyl isothiocyanate;1-ethoxy-2-isothiocyanatobenzene |
| MF | C9H9NOS |
| Berat Molekul | 179.2389 |
| InChI | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| CAS NO | 23163-84-0 |
| EINECS | 245-468-9 |
| Struktur Molekul |  |
| Kepadatan | 1.06g/cm3 |
| Titik didih | 293.2°C at 760 mmHg |
| Indeks bias | 1.544 |
| Titik nyala | 131.1°C |
| Tekanan wap | 0.00306mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 