Chemindex > 23163-84-0
NO ▼
23163-84-0 2-ethoxyphenyl isothiocyanate |
|
| produktnavn | 2-ethoxyphenyl isothiocyanate |
| Engelsk navn | 2-ethoxyphenyl isothiocyanate;o-Ethoxyphenyl isothiocyanate;1-ethoxy-2-isothiocyanatobenzene |
| Molekylær Formel | C9H9NOS |
| Molekylvekt | 179.2389 |
| InChI | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| CAS-nummer | 23163-84-0 |
| EINECS | 245-468-9 |
| Molecular Structure |  |
| Tetthet | 1.06g/cm3 |
| Kokepunkt | 293.2°C at 760 mmHg |
| Brytningsindeks | 1.544 |
| Flammepunktet | 131.1°C |
| Damptrykk | 0.00306mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 