Chemindex > 23163-84-0
PL ▼
23163-84-0 2-ethoxyphenyl isothiocyanate |
|
| Nazwa produktu: | 2-ethoxyphenyl isothiocyanate |
| Angielska nazwa | 2-ethoxyphenyl isothiocyanate;o-Ethoxyphenyl isothiocyanate;1-ethoxy-2-isothiocyanatobenzene |
| MF | C9H9NOS |
| Masie cząsteczkowej | 179.2389 |
| InChI | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| Nr CAS | 23163-84-0 |
| EINECS | 245-468-9 |
| Struktury molekularnej |  |
| Gęstość | 1.06g/cm3 |
| Temperatura wrzenia | 293.2°C at 760 mmHg |
| Współczynnik załamania | 1.544 |
| Temperatura zapłonu | 131.1°C |
| Ciśnienie pary | 0.00306mmHg at 25°C |
| Symbole zagrożenia |  Xn##Harmful:; |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 