Chemindex > 23163-84-0
IL ▼
23163-84-0 2-ethoxyphenyl isothiocyanate |
|
| שם המוצר | 2-ethoxyphenyl isothiocyanate |
| שם אנגלי | 2-ethoxyphenyl isothiocyanate;o-Ethoxyphenyl isothiocyanate;1-ethoxy-2-isothiocyanatobenzene |
| מולקולרית פורמולה | C9H9NOS |
| משקל מולקולרי | 179.2389 |
| InChl | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| מספר CAS | 23163-84-0 |
| EINECS | 245-468-9 |
| מבנה מולקולרי |  |
| צפיפות | 1.06g/cm3 |
| נקודת רתיחה | 293.2°C at 760 mmHg |
| משקל סגולי | 1.544 |
| נקודת הבזק | 131.1°C |
| לחץ אדים | 0.00306mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful:; |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 