ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175277-93-7 2-Amino-6-fluorobenzylamine |
|
اسم المنتج | 2-Amino-6-fluorobenzylamine |
الاسم بالانجليزية | 2-Amino-6-fluorobenzylamine;2-(Aminomethyl)-3-fluoroaniline |
الصيغة الجزيئية | C7H9FN2 |
الوزن الجزيئي الغرامي | 140.1582 |
InChI | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
إستراتيجية المساعدة القطرية | 175277-93-7 |
بنية جزيئية | |
كثافة | 1.209g/cm3 |
نقطة الغليان | 265°C at 760 mmHg |
معامل الإنكسار | 1.586 |
نقطة الوميض | 117.4°C |
ضغط البخار | 0.00939mmHg at 25°C |
علامات على البضائع الخطرة | C##Corrosive:; |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |