ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175277-93-7 2-Amino-6-fluorobenzylamine |
|
Ονομασία του προϊόντος | 2-Amino-6-fluorobenzylamine |
Αγγλικό όνομα | 2-Amino-6-fluorobenzylamine;2-(Aminomethyl)-3-fluoroaniline |
MF | C7H9FN2 |
Μοριακό βάρος | 140.1582 |
InChI | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
CAS ΟΧΙ | 175277-93-7 |
Μοριακή δομή | |
Πυκνότητα | 1.209g/cm3 |
Σημείο βρασμού | 265°C at 760 mmHg |
Δείκτης διάθλασης | 1.586 |
Σημείο ανάφλεξης | 117.4°C |
Πίεση ατμών | 0.00939mmHg at 25°C |
Σύμβολα επικινδυνότητας | C##Corrosive:; |
Κινδύνου Κώδικες | R34##Causes burns.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |