ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175277-93-7 2-Amino-6-fluorobenzylamine |
|
उत्पाद का नाम | 2-Amino-6-fluorobenzylamine |
अंग्रेज | 2-Amino-6-fluorobenzylamine;2-(Aminomethyl)-3-fluoroaniline |
आणविक फार्मूला | C7H9FN2 |
आण्विक वजन | 140.1582 |
InChI | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
कैस रजिस्टी संख्या | 175277-93-7 |
आणविक संरचना | |
घनत्व | 1.209g/cm3 |
उबलने का समय | 265°C at 760 mmHg |
अपवर्तक सूचकांक | 1.586 |
फ्लैश प्वाइंट | 117.4°C |
वाष्प का दबाव | 0.00939mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |