ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175277-93-7 2-Amino-6-fluorobenzylamine |
|
שם המוצר | 2-Amino-6-fluorobenzylamine |
שם אנגלי | 2-Amino-6-fluorobenzylamine;2-(Aminomethyl)-3-fluoroaniline |
מולקולרית פורמולה | C7H9FN2 |
משקל מולקולרי | 140.1582 |
InChl | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
מספר CAS | 175277-93-7 |
מבנה מולקולרי | |
צפיפות | 1.209g/cm3 |
נקודת רתיחה | 265°C at 760 mmHg |
משקל סגולי | 1.586 |
נקודת הבזק | 117.4°C |
לחץ אדים | 0.00939mmHg at 25°C |
Hazard סימנים | C##Corrosive:; |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |