ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175277-93-7 2-Amino-6-fluorobenzylamine |
|
termék neve | 2-Amino-6-fluorobenzylamine |
Angol név | 2-Amino-6-fluorobenzylamine;2-(Aminomethyl)-3-fluoroaniline |
MF | C7H9FN2 |
Molekulatömeg | 140.1582 |
InChI | InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
CAS-szám | 175277-93-7 |
Molekuláris szerkezete | |
Sűrűség | 1.209g/cm3 |
Forráspont | 265°C at 760 mmHg |
Törésmutató | 1.586 |
Gyulladáspont | 117.4°C |
Gőznyomás | 0.00939mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |