ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4331-54-8 4-methyl-1-cyclohexanecarboxylic acid |
|
produktnavn | 4-methyl-1-cyclohexanecarboxylic acid |
Engelsk navn | 4-methyl-1-cyclohexanecarboxylic acid;4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans |
Molekylær Formel | C8H14O2 |
Molekylvekt | 142.2 |
InChI | InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
CAS-nummer | 4331-54-8 |
EINECS | 224-369-4 |
Molecular Structure | |
Tetthet | 1.005 |
Kokepunkt | 134-136℃ (15 mmHg) |
Brytningsindeks | 1.4598 |
Flammepunktet | >110℃ |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22||R36:; |
Sikkerhet Beskrivelse | S26:; |
MSDS |