Chemindex > 4331-54-8 4-methyl-1-cyclohexanecarboxylic acid
NL ▼
4331-54-8 4-methyl-1-cyclohexanecarboxylic acid |
|
| Naam product | 4-methyl-1-cyclohexanecarboxylic acid |
| Engelse naam | 4-methyl-1-cyclohexanecarboxylic acid;4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans |
| MF | C8H14O2 |
| Molecuulgewicht | 142.2 |
| InChI | InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| CAS-nummer | 4331-54-8 |
| EINECS | 224-369-4 |
| Moleculaire Structuur |  |
| Dichtheid | 1.005 |
| Kookpunt | 134-136℃ (15 mmHg) |
| Brekingsindex | 1.4598 |
| Vlampunt | >110℃ |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R22||R36:; |
| Veiligheid Omschrijving | S26:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 4331-54-8(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 