Chemindex > 4331-54-8 4-methyl-1-cyclohexanecarboxylic acid
DE ▼
4331-54-8 4-methyl-1-cyclohexanecarboxylic acid |
|
| Produkt-Name | 4-methyl-1-cyclohexanecarboxylic acid |
| Englischer Name | 4-methyl-1-cyclohexanecarboxylic acid;4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans |
| Molekulare Formel | C8H14O2 |
| Molecular Weight | 142.2 |
| InChl | InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| CAS Registry Number | 4331-54-8 |
| EINECS | 224-369-4 |
| Molecular Structure |  |
| Dichte | 1.005 |
| Siedepunkt | 134-136℃ (15 mmHg) |
| Brechungsindex | 1.4598 |
| Flammpunkt | >110℃ |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R22||R36:; |
| Safety Beschreibung | S26:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 4331-54-8(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 