ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4331-54-8 4-methyl-1-cyclohexanecarboxylic acid |
|
상품명칭 | 4-methyl-1-cyclohexanecarboxylic acid |
영문 이름 | 4-methyl-1-cyclohexanecarboxylic acid;4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans |
분자식 | C8H14O2 |
분자량 | 142.2 |
InChI | InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
cas번호 | 4331-54-8 |
EC번호 | 224-369-4 |
분자 구조 | |
밀도 | 1.005 |
비등점 | 134-136℃ (15 mmHg) |
굴절 지수 | 1.4598 |
인화점 | >110℃ |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R22||R36:; |
보안 규칙 | S26:; |
MSDS |