ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4331-54-8 4-methyl-1-cyclohexanecarboxylic acid |
|
Nome del prodotto | 4-methyl-1-cyclohexanecarboxylic acid |
Nome inglese | 4-methyl-1-cyclohexanecarboxylic acid;4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans |
Formula molecolare | C8H14O2 |
Peso Molecolare | 142.2 |
InChI | InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
Numero CAS | 4331-54-8 |
EINECS | 224-369-4 |
Struttura molecolare | |
Densità | 1.005 |
Punto di ebollizione | 134-136℃ (15 mmHg) |
Indice di rifrazione | 1.4598 |
Punto d'infiammabilità | >110℃ |
Simboli di pericolo | Xn##Harmful:; |
Codici di Rischio | R22||R36:; |
Sicurezza Descrizione | S26:; |
MSDS |