ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41433-81-2 Hexadecylmalonic acid diethyl ester |
|
상품명칭 | Hexadecylmalonic acid diethyl ester |
영문 이름 | Hexadecylmalonic acid diethyl ester;n-Hexadecylmalonic acid diethyl ester;Diethyl n-hexadecylmalonate;diethyl hexadecylpropanedioate |
분자식 | C23H44O4 |
분자량 | 384.5931 |
InChI | InChI=1/C23H44O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)26-5-2)23(25)27-6-3/h21H,4-20H2,1-3H3 |
cas번호 | 41433-81-2 |
EC번호 | 255-364-5 |
분자 구조 | |
밀도 | 0.925g/cm3 |
비등점 | 401.8°C at 760 mmHg |
굴절 지수 | 1.452 |
인화점 | 178.9°C |
증기압 | 1.15E-06mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |