ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41433-81-2 Hexadecylmalonic acid diethyl ester |
|
उत्पाद का नाम | Hexadecylmalonic acid diethyl ester |
अंग्रेज | Hexadecylmalonic acid diethyl ester;n-Hexadecylmalonic acid diethyl ester;Diethyl n-hexadecylmalonate;diethyl hexadecylpropanedioate |
आणविक फार्मूला | C23H44O4 |
आण्विक वजन | 384.5931 |
InChI | InChI=1/C23H44O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)26-5-2)23(25)27-6-3/h21H,4-20H2,1-3H3 |
कैस रजिस्टी संख्या | 41433-81-2 |
EINECS | 255-364-5 |
आणविक संरचना | |
घनत्व | 0.925g/cm3 |
उबलने का समय | 401.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.452 |
फ्लैश प्वाइंट | 178.9°C |
वाष्प का दबाव | 1.15E-06mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |