ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41433-81-2 Hexadecylmalonic acid diethyl ester |
|
Nama produk | Hexadecylmalonic acid diethyl ester |
Nama bahasa Inggris | Hexadecylmalonic acid diethyl ester;n-Hexadecylmalonic acid diethyl ester;Diethyl n-hexadecylmalonate;diethyl hexadecylpropanedioate |
MF | C23H44O4 |
Berat Molekul | 384.5931 |
InChI | InChI=1/C23H44O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)26-5-2)23(25)27-6-3/h21H,4-20H2,1-3H3 |
CAS NO | 41433-81-2 |
EINECS | 255-364-5 |
Struktur Molekul | |
Kepadatan | 0.925g/cm3 |
Titik didih | 401.8°C at 760 mmHg |
Indeks bias | 1.452 |
Titik nyala | 178.9°C |
Tekanan uap | 1.15E-06mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |