ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41433-81-2 Hexadecylmalonic acid diethyl ester |
|
Produkt-Name | Hexadecylmalonic acid diethyl ester |
Englischer Name | Hexadecylmalonic acid diethyl ester;n-Hexadecylmalonic acid diethyl ester;Diethyl n-hexadecylmalonate;diethyl hexadecylpropanedioate |
Molekulare Formel | C23H44O4 |
Molecular Weight | 384.5931 |
InChl | InChI=1/C23H44O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)26-5-2)23(25)27-6-3/h21H,4-20H2,1-3H3 |
CAS Registry Number | 41433-81-2 |
EINECS | 255-364-5 |
Molecular Structure | |
Dichte | 0.925g/cm3 |
Siedepunkt | 401.8°C at 760 mmHg |
Brechungsindex | 1.452 |
Flammpunkt | 178.9°C |
Dampfdruck | 1.15E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |