ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41433-81-2 Hexadecylmalonic acid diethyl ester |
|
Nome del prodotto | Hexadecylmalonic acid diethyl ester |
Nome inglese | Hexadecylmalonic acid diethyl ester;n-Hexadecylmalonic acid diethyl ester;Diethyl n-hexadecylmalonate;diethyl hexadecylpropanedioate |
Formula molecolare | C23H44O4 |
Peso Molecolare | 384.5931 |
InChI | InChI=1/C23H44O4/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)26-5-2)23(25)27-6-3/h21H,4-20H2,1-3H3 |
Numero CAS | 41433-81-2 |
EINECS | 255-364-5 |
Struttura molecolare | |
Densità | 0.925g/cm3 |
Punto di ebollizione | 401.8°C at 760 mmHg |
Indice di rifrazione | 1.452 |
Punto d'infiammabilità | 178.9°C |
Pressione di vapore | 1.15E-06mmHg at 25°C |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |