ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24068-15-3 2-Klorometil-5- (4-klorofenil) -1,2,4-oksadiazol |
|
Ürün Adı | 2-Klorometil-5- (4-klorofenil) -1,2,4-oksadiazol |
Eş anlamlı | 2-Klorometil-5- (4-klorofenil) -1,3,4-oksadiazol; |
ingilizce adı | 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole;2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
Moleküler Formülü | C9H6Cl2N2O |
Molekül Ağırlığı | 229.0627 |
InChI | InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
CAS kayıt numarası | 24068-15-3 |
Moleküler Yapısı | |
Yoğunluk | 1.4g/cm3 |
Ergime noktası | 81℃ |
Kaynama noktası | 343.8°C at 760 mmHg |
Kırılma indisi | 1.574 |
Alevlenme noktası | 161.7°C |
Buhar basıncı | 0.000136mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |