ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24068-15-3 2-کلرومتیل-5- (4-کلروفنیل) -1،2،4-اکسادیازول؛ 2-کلرومتیل-5- (4-کلروفنیل) -1،3،4-اکسادیازول؛ |
|
نام محصول | 2-کلرومتیل-5- (4-کلروفنیل) -1،2،4-اکسادیازول؛ 2-کلرومتیل-5- (4-کلروفنیل) -1،3،4-اکسادیازول؛ |
نام انگلیسی | 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole;2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
میدان مغناطیسی | C9H6Cl2N2O |
وزن مولکولی | 229.0627 |
InChI | InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
شماره سیایاس | 24068-15-3 |
ساختار مولکولی | |
تراکم | 1.4g/cm3 |
نقطه ذوب | 81℃ |
نقطه غلیان | 343.8°C at 760 mmHg |
ضریب شکست | 1.574 |
نقطه اشتعال | 161.7°C |
فشار بخار | 0.000136mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |