ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24068-15-3 2-klormetyl-5-(4-klorfenyl)-1,2,4-oksadiazol |
|
produktnavn | 2-klormetyl-5-(4-klorfenyl)-1,2,4-oksadiazol |
Synonymer | ; 2-klormetyl-5-(4-klorfenyl)-1,3,4-oksadiazol; |
Engelsk navn | 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole;2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
Molekylær Formel | C9H6Cl2N2O |
Molekylvekt | 229.0627 |
InChI | InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
CAS-nummer | 24068-15-3 |
Molecular Structure | |
Tetthet | 1.4g/cm3 |
Smeltepunkt | 81℃ |
Kokepunkt | 343.8°C at 760 mmHg |
Brytningsindeks | 1.574 |
Flammepunktet | 161.7°C |
Damptrykk | 0.000136mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |