ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24068-15-3 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole |
|
Nama produk | 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole |
Sinonim | ; 2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole; |
Nama Inggeris | 2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole;2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
MF | C9H6Cl2N2O |
Berat Molekul | 229.0627 |
InChI | InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
CAS NO | 24068-15-3 |
Struktur Molekul | |
Kepadatan | 1.4g/cm3 |
Titik lebur | 81℃ |
Titik didih | 343.8°C at 760 mmHg |
Indeks bias | 1.574 |
Titik nyala | 161.7°C |
Tekanan wap | 0.000136mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |