ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40811-49-2 Isopropylthioethanol; 95% |
|
اسم المنتج | Isopropylthioethanol; 95% |
الاسم بالانجليزية | Isopropylthioethanol; 95%;2-(Isopropylthio)ethanol;2-Hydroxyethyl isopropyl sulphide;2-(propan-2-ylsulfanyl)ethanol |
الصيغة الجزيئية | C5H12OS |
الوزن الجزيئي الغرامي | 120.2132 |
InChI | InChI=1/C5H12OS/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
إستراتيجية المساعدة القطرية | 40811-49-2 |
المفوضية الأوروبية رقم | 255-090-6 |
بنية جزيئية | |
كثافة | 0.977g/cm3 |
نقطة الغليان | 191.3°C at 760 mmHg |
معامل الإنكسار | 1.476 |
نقطة الوميض | 94°C |
ضغط البخار | 0.139mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |