ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40811-49-2 Isopropylthioethanol; 95% |
|
Ονομασία του προϊόντος | Isopropylthioethanol; 95% |
Αγγλικό όνομα | Isopropylthioethanol; 95%;2-(Isopropylthio)ethanol;2-Hydroxyethyl isopropyl sulphide;2-(propan-2-ylsulfanyl)ethanol |
MF | C5H12OS |
Μοριακό βάρος | 120.2132 |
InChI | InChI=1/C5H12OS/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
CAS ΟΧΙ | 40811-49-2 |
EINECS | 255-090-6 |
Μοριακή δομή | |
Πυκνότητα | 0.977g/cm3 |
Σημείο βρασμού | 191.3°C at 760 mmHg |
Δείκτης διάθλασης | 1.476 |
Σημείο ανάφλεξης | 94°C |
Πίεση ατμών | 0.139mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |