ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40811-49-2 Isopropylthioethanol; 95% |
|
שם המוצר | Isopropylthioethanol; 95% |
שם אנגלי | Isopropylthioethanol; 95%;2-(Isopropylthio)ethanol;2-Hydroxyethyl isopropyl sulphide;2-(propan-2-ylsulfanyl)ethanol |
מולקולרית פורמולה | C5H12OS |
משקל מולקולרי | 120.2132 |
InChl | InChI=1/C5H12OS/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
מספר CAS | 40811-49-2 |
EINECS | 255-090-6 |
מבנה מולקולרי | |
צפיפות | 0.977g/cm3 |
נקודת רתיחה | 191.3°C at 760 mmHg |
משקל סגולי | 1.476 |
נקודת הבזק | 94°C |
לחץ אדים | 0.139mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |