Chemindex > 40811-49-2
NL â–¼
40811-49-2 Isopropylthioethanol; 95% |
|
| Naam product | Isopropylthioethanol; 95% |
| Engelse naam | Isopropylthioethanol; 95%;2-(Isopropylthio)ethanol;2-Hydroxyethyl isopropyl sulphide;2-(propan-2-ylsulfanyl)ethanol |
| MF | C5H12OS |
| Molecuulgewicht | 120.2132 |
| InChI | InChI=1/C5H12OS/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
| CAS-nummer | 40811-49-2 |
| EINECS | 255-090-6 |
| Moleculaire Structuur |  |
| Dichtheid | 0.977g/cm3 |
| Kookpunt | 191.3°C at 760 mmHg |
| Brekingsindex | 1.476 |
| Vlampunt | 94°C |
| Dampdruk | 0.139mmHg at 25°C |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Veiligheid Omschrijving | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 40811-49-2 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 