ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98591-60-7 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
|
Nazwa produktu: | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
Angielska nazwa | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride; |
MF | C9H5ClN2O2 |
Masie cząsteczkowej | 208.6012 |
InChI | InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H |
Nr CAS | 98591-60-7 |
Struktury molekularnej | |
Gęstość | 1.387g/cm3 |
Temperatura topnienia | 80℃ |
Temperatura wrzenia | 352.1°C at 760 mmHg |
Współczynnik załamania | 1.573 |
Temperatura zapłonu | 166.8°C |
Ciśnienie pary | 3.92E-05mmHg at 25°C |
Symbole zagrożenia | C##Corrosive:; |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |