Chemindex > 98591-60-7
KR ▼
98591-60-7 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
|
| 상품명칭 | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
| 영문 이름 | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride; |
| 분자식 | C9H5ClN2O2 |
| 분자량 | 208.6012 |
| InChI | InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H |
| cas번호 | 98591-60-7 |
| 분자 구조 |  |
| 밀도 | 1.387g/cm3 |
| 녹는 점 | 80℃ |
| 비등점 | 352.1°C at 760 mmHg |
| 굴절 지수 | 1.573 |
| 인화점 | 166.8°C |
| 증기압 | 3.92E-05mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
98591-60-7 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 