ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98591-60-7 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
|
Ürün Adı | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
ingilizce adı | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride; |
Moleküler Formülü | C9H5ClN2O2 |
Molekül Ağırlığı | 208.6012 |
InChI | InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H |
CAS kayıt numarası | 98591-60-7 |
Moleküler Yapısı | |
Yoğunluk | 1.387g/cm3 |
Ergime noktası | 80℃ |
Kaynama noktası | 352.1°C at 760 mmHg |
Kırılma indisi | 1.573 |
Alevlenme noktası | 166.8°C |
Buhar basıncı | 3.92E-05mmHg at 25°C |
Tehlike Sembolleri | C##Corrosive:; |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |