ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98591-60-7 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
|
उत्पाद का नाम | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride |
अंग्रेज | 5-phenyl-1,3,4-oxadiazole-2-carbonyl chloride; |
आणविक फार्मूला | C9H5ClN2O2 |
आण्विक वजन | 208.6012 |
InChI | InChI=1/C9H5ClN2O2/c10-7(13)9-12-11-8(14-9)6-4-2-1-3-5-6/h1-5H |
कैस रजिस्टी संख्या | 98591-60-7 |
आणविक संरचना | |
घनत्व | 1.387g/cm3 |
गलनांक | 80℃ |
उबलने का समय | 352.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.573 |
फ्लैश प्वाइंट | 166.8°C |
वाष्प का दबाव | 3.92E-05mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |