ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
Ürün Adı | hydroxypropyl acrylate, mixture of isomers |
ingilizce adı | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
Moleküler Formülü | C6H10O3 |
Molekül Ağırlığı | 130.1418 |
InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
CAS kayıt numarası | 25584-83-2 |
EINECS | 247-118-0 |
Moleküler Yapısı | |
Yoğunluk | 1.049g/cm3 |
Kaynama noktası | 175.4°C at 760 mmHg |
Kırılma indisi | 1.442 |
Alevlenme noktası | 64.3°C |
Buhar basıncı | 0.355mmHg at 25°C |
Tehlike Sembolleri | T##Toxic:; |
Risk Kodları | R23/24/25||R34||R43:; |
Güvenlik Açıklaması | S26||S36/37/39||S45:; |
MSDS |