ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
Nama produk | hydroxypropyl acrylate, mixture of isomers |
Nama Inggeris | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
MF | C6H10O3 |
Berat Molekul | 130.1418 |
InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
CAS NO | 25584-83-2 |
EINECS | 247-118-0 |
Struktur Molekul | |
Kepadatan | 1.049g/cm3 |
Titik didih | 175.4°C at 760 mmHg |
Indeks bias | 1.442 |
Titik nyala | 64.3°C |
Tekanan wap | 0.355mmHg at 25°C |
Cinta bahaya | T##Toxic:; |
Kod Risiko | R23/24/25||R34||R43:; |
Keselamatan Penerangan | S26||S36/37/39||S45:; |
MSDS |